EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O3 |
| Net Charge | 0 |
| Average Mass | 227.264 |
| Monoisotopic Mass | 227.12699 |
| SMILES | [H][C@]1(CC(N)=O)NC(=O)[C@@]([H])(C(C)CC)NC1=O |
| InChI | InChI=1S/C10H17N3O3/c1-3-5(2)8-10(16)12-6(4-7(11)14)9(15)13-8/h5-6,8H,3-4H2,1-2H3,(H2,11,14)(H,12,16)(H,13,15)/t5?,6-,8-/m1/s1 |
| InChIKey | LYDWCUQSOZRMRD-KYVYOHOSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | - | PubMed (15863936) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-acetamino-6-isobutyl-2,5-dioxopiperazine (CHEBI:65362) has role antineoplastic agent (CHEBI:35610) |
| 3-acetamino-6-isobutyl-2,5-dioxopiperazine (CHEBI:65362) has role metabolite (CHEBI:25212) |
| 3-acetamino-6-isobutyl-2,5-dioxopiperazine (CHEBI:65362) is a 2,5-diketopiperazines (CHEBI:65061) |
| IUPAC Name |
|---|
| 2-[(2R,5R)-5-(butan-2-yl)-3,6-dioxopiperazin-2-yl]acetamide |
| Citations |
|---|