EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(O)cc2O)cc(CC=C(C)C)c1O |
| InChI | InChI=1S/C21H22O5/c1-13(2)4-6-15-10-14(11-20(26-3)21(15)25)5-9-18(23)17-8-7-16(22)12-19(17)24/h4-5,7-12,22,24-25H,6H2,1-3H3/b9-5+ |
| InChIKey | XHBJLRFVAGPAOY-WEVVVXLNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina abyssinica (ncbitaxon:1237573) | stem (BTO:0001300) | PubMed (18484536) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abyssinone D (CHEBI:65360) has role antineoplastic agent (CHEBI:35610) |
| abyssinone D (CHEBI:65360) has role metabolite (CHEBI:25212) |
| abyssinone D (CHEBI:65360) is a aromatic ether (CHEBI:35618) |
| abyssinone D (CHEBI:65360) is a chalcones (CHEBI:23086) |
| abyssinone D (CHEBI:65360) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| (2E)-1-(2,4-dihydroxyphenyl)-3-[4-hydroxy-3-methoxy-5-(3-methylbut-2-en-1-yl)phenyl]prop-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18567988 | Reaxys |
| Citations |
|---|