EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O7 |
| Net Charge | 0 |
| Average Mass | 372.373 |
| Monoisotopic Mass | 372.12090 |
| SMILES | CC1(C)Oc2c(O)cc(/C=C/C(=O)c3ccc(O)cc3O)cc2C(O)C1O |
| InChI | InChI=1S/C20H20O7/c1-20(2)19(26)17(25)13-7-10(8-16(24)18(13)27-20)3-6-14(22)12-5-4-11(21)9-15(12)23/h3-9,17,19,21,23-26H,1-2H3/b6-3+ |
| InChIKey | VRYBZCIONJZZPL-ZZXKWVIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina abyssinica (ncbitaxon:1237573) | stem (BTO:0001300) | PubMed (18484536) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abyssinone C (CHEBI:65359) has role antineoplastic agent (CHEBI:35610) |
| abyssinone C (CHEBI:65359) has role metabolite (CHEBI:25212) |
| abyssinone C (CHEBI:65359) is a chalcones (CHEBI:23086) |
| abyssinone C (CHEBI:65359) is a chromenol (CHEBI:39436) |
| abyssinone C (CHEBI:65359) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| (2E)-1-(2,4-dihydroxyphenyl)-3-(3,4,8-trihydroxy-2,2-dimethyl-3,4-dihydro-2H-chromen-6-yl)prop-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18567990 | Reaxys |
| Citations |
|---|