EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | CC1(C)C=Cc2cc(/C=C/C(=O)c3ccc(O)cc3O)cc(O)c2O1 |
| InChI | InChI=1S/C20H18O5/c1-20(2)8-7-13-9-12(10-18(24)19(13)25-20)3-6-16(22)15-5-4-14(21)11-17(15)23/h3-11,21,23-24H,1-2H3/b6-3+ |
| InChIKey | OKKOOVXXLBMKQH-ZZXKWVIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina abyssinica (ncbitaxon:1237573) | stem (BTO:0001300) | PubMed (18484536) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abyssinone A (CHEBI:65358) has role antineoplastic agent (CHEBI:35610) |
| abyssinone A (CHEBI:65358) has role metabolite (CHEBI:25212) |
| abyssinone A (CHEBI:65358) is a chalcones (CHEBI:23086) |
| abyssinone A (CHEBI:65358) is a chromenol (CHEBI:39436) |
| abyssinone A (CHEBI:65358) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| (2E)-1-(2,4-dihydroxyphenyl)-3-(8-hydroxy-2,2-dimethyl-2H-chromen-6-yl)prop-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18567987 | Reaxys |
| Citations |
|---|