EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O9 |
| Net Charge | 0 |
| Average Mass | 460.479 |
| Monoisotopic Mass | 460.17333 |
| SMILES | [H][C@]12Oc3c(C)c(O)c(C)c4c3[C@]([H])(C[C@@H](c3ccc(OC)cc3)O4)O[C@]1([H])[C@@H](O)[C@H](O)[C@@H](CO)O2 |
| InChI | InChI=1S/C24H28O9/c1-10-18(26)11(2)22-17-15(31-23-20(28)19(27)16(9-25)32-24(23)33-22)8-14(30-21(10)17)12-4-6-13(29-3)7-5-12/h4-7,14-16,19-20,23-28H,8-9H2,1-3H3/t14-,15-,16+,19+,20-,23+,24-/m0/s1 |
| InChIKey | BVWNFYIRLQDZHV-QSNPKDTKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Abacopteris penangiana (IPNI:17367310-1) | rhizome (BTO:0001181) | PubMed (16499328) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abacopterin C (CHEBI:65356) has functional parent β-D-glucose (CHEBI:15903) |
| abacopterin C (CHEBI:65356) has role plant metabolite (CHEBI:76924) |
| abacopterin C (CHEBI:65356) is a carbohydrate derivative (CHEBI:63299) |
| abacopterin C (CHEBI:65356) is a organic heterotetracyclic compound (CHEBI:38163) |
| abacopterin C (CHEBI:65356) is a polycyclic ether (CHEBI:36468) |
| IUPAC Name |
|---|
| (2S,7aS,9R,10S,11S,11aR,12aS)-9-(hydroxymethyl)-2-(4-methoxyphenyl)-4,6-dimethyl-1,9,10,11,11a,12a-hexahydro-2H,7aH-pyrano[2',3':2,3][1,4]dioxepino[5,6,7-de]chromene-5,10,11-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11212419 | Reaxys |
| Citations |
|---|