EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O10 |
| Net Charge | 0 |
| Average Mass | 502.516 |
| Monoisotopic Mass | 502.18390 |
| SMILES | [H][C@]12Oc3c(C)c(O)c(C)c4c3[C@]([H])(C[C@@H](c3ccc(OC)cc3)O4)O[C@]1([H])[C@@H](O)[C@H](O)[C@@H](COC(C)=O)O2 |
| InChI | InChI=1S/C26H30O10/c1-11-20(28)12(2)24-19-17(9-16(33-23(11)19)14-5-7-15(31-4)8-6-14)34-25-22(30)21(29)18(10-32-13(3)27)35-26(25)36-24/h5-8,16-18,21-22,25-26,28-30H,9-10H2,1-4H3/t16-,17-,18+,21+,22-,25+,26-/m0/s1 |
| InChIKey | IFELYQDGJJZHIW-KPBPQVAGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Abacopteris penangiana (IPNI:17367310-1) | rhizome (BTO:0001181) | PubMed (16499328) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abacopterin A (CHEBI:65354) has functional parent 6-O-acetyl-β-D-glucose (CHEBI:62111) |
| abacopterin A (CHEBI:65354) has role plant metabolite (CHEBI:76924) |
| abacopterin A (CHEBI:65354) is a carbohydrate derivative (CHEBI:63299) |
| abacopterin A (CHEBI:65354) is a organic heterotetracyclic compound (CHEBI:38163) |
| abacopterin A (CHEBI:65354) is a polycyclic ether (CHEBI:36468) |
| IUPAC Name |
|---|
| [(2S,7aS,9R,10S,11S,11aR,12aS)-5,10,11-trihydroxy-2-(4-methoxyphenyl)-4,6-dimethyl-1,9,10,11,11a,12a-hexahydro-2H,7aH-pyrano[2',3':2,3][1,4]dioxepino[5,6,7-de]chromen-9-yl]methyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15872093 | Reaxys |
| Citations |
|---|