EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14ClN |
| Net Charge | 0 |
| Average Mass | 195.693 |
| Monoisotopic Mass | 195.08148 |
| SMILES | C[C@H]1CNCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H14ClN/c1-8-7-13-5-4-9-2-3-10(12)6-11(8)9/h2-3,6,8,13H,4-5,7H2,1H3/t8-/m0/s1 |
| InChIKey | XTTZERNUQAFMOF-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | appetite depressant Any agent that is used to decrease appetite. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lorcaserin (CHEBI:65353) has role anti-obesity agent (CHEBI:74518) |
| lorcaserin (CHEBI:65353) has role appetite depressant (CHEBI:50507) |
| lorcaserin (CHEBI:65353) is a benzazepine (CHEBI:35676) |
| lorcaserin (CHEBI:65353) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| (1R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| INN | Source |
|---|---|
| lorcaserin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4374 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9904422 | Reaxys |
| CAS:616202-92-7 | ChemIDplus |