EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N3O16 |
| Net Charge | 0 |
| Average Mass | 591.479 |
| Monoisotopic Mass | 591.15478 |
| SMILES | O=C(C[C@@](O)(CC(=O)OCCN1C(=O)CCC1(O)C(=O)O)C(=O)O)NCCC(C(=O)O)N1C(=O)CCC1(O)C(=O)O |
| InChI | InChI=1S/C22H29N3O16/c26-12(23-6-3-11(16(30)31)25-14(28)2-5-22(25,40)19(36)37)9-20(38,17(32)33)10-15(29)41-8-7-24-13(27)1-4-21(24,39)18(34)35/h11,38-40H,1-10H2,(H,23,26)(H,30,31)(H,32,33)(H,34,35)(H,36,37)/t11?,20-,21?,22?/m1/s1 |
| InChIKey | JIVPNYWQBCSFIL-MAVSXWESSA-N |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| achromobactin free acid (CHEBI:65352) has role siderophore (CHEBI:26672) |
| achromobactin free acid (CHEBI:65352) is a N-acyl hemiaminal (CHEBI:142734) |
| achromobactin free acid (CHEBI:65352) is a tetracarboxylic acid (CHEBI:35742) |
| achromobactin free acid (CHEBI:65352) is conjugate acid of achromobactin (CHEBI:61346) |
| Incoming Relation(s) |
| achromobactin (CHEBI:61346) is conjugate base of achromobactin free acid (CHEBI:65352) |
| Citations |
|---|