EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H57N5O7 |
| Net Charge | 0 |
| Average Mass | 719.924 |
| Monoisotopic Mass | 719.42580 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCc1ccccc1)NC(=O)CN1CCOCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C40H57N5O7/c1-27(2)22-32(36(47)40(5)26-52-40)42-39(50)34(24-30-14-10-7-11-15-30)44-38(49)33(23-28(3)4)43-37(48)31(17-16-29-12-8-6-9-13-29)41-35(46)25-45-18-20-51-21-19-45/h6-15,27-28,31-34H,16-26H2,1-5H3,(H,41,46)(H,42,50)(H,43,48)(H,44,49)/t31-,32-,33-,34-,40+/m0/s1 |
| InChIKey | BLMPQMFVWMYDKT-NZTKNTHTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carfilzomib (CHEBI:65347) has role antineoplastic agent (CHEBI:35610) |
| carfilzomib (CHEBI:65347) has role proteasome inhibitor (CHEBI:52726) |
| carfilzomib (CHEBI:65347) is a epoxide (CHEBI:32955) |
| carfilzomib (CHEBI:65347) is a morpholines (CHEBI:38785) |
| carfilzomib (CHEBI:65347) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| N-{(2S)-2-[(morpholin-4-ylacetyl)amino]-4-phenylbutanoyl}-L-leucyl-N-{(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl}-L-phenylalaninamide |
| INN | Source |
|---|---|
| carfilzomib | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Kyprolis | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4483 | DrugCentral |
| Carfilzomib | Wikipedia |
| D08880 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12488950 | Reaxys |
| CAS:868540-17-4 | KEGG DRUG |
| CAS:868540-17-4 | ChemIDplus |
| Citations |
|---|