EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H53N8O21P3S |
| Net Charge | 0 |
| Average Mass | 998.789 |
| Monoisotopic Mass | 998.22588 |
| SMILES | CN[C@@H](COP(=O)(O)OC[C@H]1O[C@@H](O[C@@H]2[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCS)O[C@H]2n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C(C)=O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-(5''-phosphoribosyl)-3'-dephospho-CoA serine residue (CHEBI:65339) is a amino-acid residue (CHEBI:33708) |
| 2'-(5''-phosphoribosyl)-3'-dephospho-CoA serine residue (CHEBI:65339) is conjugate acid of 2'-(5''-phosphoribosyl)-3'-dephospho-CoA serine(3−) residue (CHEBI:65333) |
| Incoming Relation(s) |
| 2'-(5''-phosphoribosyl)-3'-dephospho-CoA serine(3−) residue (CHEBI:65333) is conjugate base of 2'-(5''-phosphoribosyl)-3'-dephospho-CoA serine residue (CHEBI:65339) |