EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H33ClN2O2.HCl |
| Net Charge | 0 |
| Average Mass | 513.509 |
| Monoisotopic Mass | 512.19973 |
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C29H33ClN2O2.ClH/c1-31(2)27(33)29(24-9-5-3-6-10-24,25-11-7-4-8-12-25)19-22-32-20-17-28(34,18-21-32)23-13-15-26(30)16-14-23;/h3-16,34H,17-22H2,1-2H3;1H |
| InChIKey | PGYPOBZJRVSMDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loperamide hydrochloride (CHEBI:6533) has part loperamide(1+) (CHEBI:86969) |
| loperamide hydrochloride (CHEBI:6533) has role anticoronaviral agent (CHEBI:149553) |
| loperamide hydrochloride (CHEBI:6533) has role antidiarrhoeal drug (CHEBI:55323) |
| loperamide hydrochloride (CHEBI:6533) has role μ-opioid receptor agonist (CHEBI:55322) |
| loperamide hydrochloride (CHEBI:6533) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide hydrochloride |
| 4-(4-chlorophenyl)-1-[4-(dimethylamino)-4-oxo-3,3-diphenylbutyl]-4-hydroxypiperidin-1-ium chloride |
| Synonyms | Source |
|---|---|
| 4-(p-Chlorophenyl)-4-hydroxy-N,N-dimethyl-alpha,alpha-diphenyl-1-piperidine butyramide HCl | ChemIDplus |
| 4-(p-Chlorophenyl)-4-hydroxy-N,N-dimethyl-alpha,alpha-diphenyl-1-piperidinebutyramide monohydrochloride | ChemIDplus |
| Imodium | ChemIDplus |
| Loperamide HCl | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4087090 | Reaxys |
| CAS:34552-83-5 | ChemIDplus |