EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17NO3 |
| Net Charge | 0 |
| Average Mass | 307.349 |
| Monoisotopic Mass | 307.12084 |
| SMILES | O=c1cc(N2CCOCC2)oc2c(-c3ccccc3)cccc12 |
| InChI | InChI=1S/C19H17NO3/c21-17-13-18(20-9-11-22-12-10-20)23-19-15(7-4-8-16(17)19)14-5-2-1-3-6-14/h1-8,13H,9-12H2 |
| InChIKey | CZQHHVNHHHRRDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY294002 (CHEBI:65329) has role autophagy inhibitor (CHEBI:88230) |
| LY294002 (CHEBI:65329) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| LY294002 (CHEBI:65329) has role geroprotector (CHEBI:176497) |
| LY294002 (CHEBI:65329) is a chromones (CHEBI:23238) |
| LY294002 (CHEBI:65329) is a morpholines (CHEBI:38785) |
| LY294002 (CHEBI:65329) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2-(morpholin-4-yl)-8-phenyl-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(4-morpholinyl)-8-phenyl-4H-1-benzopyran-4-one | ChemIDplus |
| 2-(4-Morpholinyl)-8-phenyl-4H-1-benzopyran-4-one | KEGG COMPOUND |
| LY 294002 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8156139 | Reaxys |
| CAS:154447-36-6 | ChemIDplus |
| CAS:154447-36-6 | KEGG COMPOUND |
| Citations |
|---|