EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N7O3S2 |
| Net Charge | 0 |
| Average Mass | 513.649 |
| Monoisotopic Mass | 513.16168 |
| SMILES | CS(=O)(=O)N1CCN(Cc2cc3nc(-c4cccc5nncc45)nc(N4CCOCC4)c3s2)CC1 |
| InChI | InChI=1S/C23H27N7O3S2/c1-35(31,32)30-7-5-28(6-8-30)15-16-13-20-21(34-16)23(29-9-11-33-12-10-29)26-22(25-20)17-3-2-4-19-18(17)14-24-27-19/h2-4,13-14H,5-12,15H2,1H3,(H,24,27) |
| InChIKey | LHNIIDJUOCFXAP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pictrelisib (CHEBI:65326) has role antineoplastic agent (CHEBI:35610) |
| pictrelisib (CHEBI:65326) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| pictrelisib (CHEBI:65326) is a indazoles (CHEBI:38769) |
| pictrelisib (CHEBI:65326) is a morpholines (CHEBI:38785) |
| pictrelisib (CHEBI:65326) is a organic heterobicyclic compound (CHEBI:27171) |
| pictrelisib (CHEBI:65326) is a organic molecular entity (CHEBI:50860) |
| pictrelisib (CHEBI:65326) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| pictrelisib (CHEBI:65326) is a organosulfur heterocyclic compound (CHEBI:38106) |
| pictrelisib (CHEBI:65326) is a piperazines (CHEBI:26144) |
| pictrelisib (CHEBI:65326) is a sulfonamide (CHEBI:35358) |
| pictrelisib (CHEBI:65326) is a thienopyrimidine (CHEBI:143212) |
| IUPAC Name |
|---|
| 2-(1H-indazol-4-yl)-6-{[4-(methylsulfonyl)piperazin-1-yl]methyl}-4-(morpholin-4-yl)thieno[3,2-d]pyrimidine |
| INN | Source |
|---|---|
| pictilisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CDC-0941 | ChEMBL |
| GDC 0941 | ChEMBL |
| GDC-0941 | ChEMBL |
| GDC0941 | ChEBI |
| pictilisib | ChEMBL |
| Pictrelisib | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15630067 | Reaxys |
| CAS:957054-30-7 | ChemIDplus |
| Citations |
|---|