EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H33ClN2O2 |
| Net Charge | 0 |
| Average Mass | 477.048 |
| Monoisotopic Mass | 476.22306 |
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H33ClN2O2/c1-31(2)27(33)29(24-9-5-3-6-10-24,25-11-7-4-8-12-25)19-22-32-20-17-28(34,18-21-32)23-13-15-26(30)16-14-23/h3-16,34H,17-22H2,1-2H3 |
| InChIKey | RDOIQAHITMMDAJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loperamide (CHEBI:6532) has role anticoronaviral agent (CHEBI:149553) |
| loperamide (CHEBI:6532) has role antidiarrhoeal drug (CHEBI:55323) |
| loperamide (CHEBI:6532) has role μ-opioid receptor agonist (CHEBI:55322) |
| loperamide (CHEBI:6532) is a monocarboxylic acid amide (CHEBI:29347) |
| loperamide (CHEBI:6532) is a monochlorobenzenes (CHEBI:83403) |
| loperamide (CHEBI:6532) is a piperidines (CHEBI:26151) |
| loperamide (CHEBI:6532) is a tertiary alcohol (CHEBI:26878) |
| loperamide (CHEBI:6532) is conjugate base of loperamide(1+) (CHEBI:86969) |
| Incoming Relation(s) |
| loperamide(1+) (CHEBI:86969) is conjugate acid of loperamide (CHEBI:6532) |
| IUPAC Name |
|---|
| 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
| INNs | Source |
|---|---|
| loperamide | ChemIDplus |
| loperamida | ChemIDplus |
| loperamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Loperamide | KEGG COMPOUND |
| lopéramide | WHO MedNet |
| Manual Xrefs | Databases |
|---|---|
| C07080 | KEGG COMPOUND |
| FR2100711 | Patent |
| US3714159 | Patent |
| Loperamide | Wikipedia |
| DB00836 | DrugBank |
| HMDB0004999 | HMDB |
| D08144 | KEGG DRUG |
| LSM-3365 | LINCS |
| 1599 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1558273 | Reaxys |
| CAS:53179-11-6 | KEGG COMPOUND |
| CAS:53179-11-6 | ChemIDplus |
| Citations |
|---|