EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N6O4 |
| Net Charge | 0 |
| Average Mass | 320.309 |
| Monoisotopic Mass | 320.12330 |
| SMILES | CN1N=C(N)c2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c3ncnc1c23 |
| InChI | InChI=1S/C13H16N6O4/c1-18-11-7-5(10(14)17-18)2-19(12(7)16-4-15-11)13-9(22)8(21)6(3-20)23-13/h2,4,6,8-9,13,20-22H,3H2,1H3,(H2,14,17)/t6-,8-,9-,13-/m1/s1 |
| InChIKey | HOGVTUZUJGHKPL-HTVVRFAVSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triciribine (CHEBI:65310) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| triciribine (CHEBI:65310) is a nucleoside analogue (CHEBI:60783) |
| IUPAC Name |
|---|
| 5-methyl-1-(β-D-ribofuranosyl)-1,5-dihydro-1,4,5,6,8-pentaazaacenaphthylen-3-amine |
| Synonym | Source |
|---|---|
| TCN | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| LSM-3810 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1171593 | Reaxys |
| CAS:35943-35-2 | ChemIDplus |
| CAS:35943-35-2 | NIST Chemistry WebBook |
| Citations |
|---|