EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27NO11 |
| Net Charge | 0 |
| Average Mass | 469.443 |
| Monoisotopic Mass | 469.15841 |
| SMILES | [H][C@]1([C@H](CO)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC(=O)[C@](O)(Cc2cnc3ccccc23)[C@@H]1O |
| InChI | InChI=1S/C21H27NO11/c23-7-12-14(25)15(26)16(27)19(31-12)32-13(8-24)17-18(28)21(30,20(29)33-17)5-9-6-22-11-4-2-1-3-10(9)11/h1-4,6,12-19,22-28,30H,5,7-8H2/t12-,13+,14-,15+,16-,17-,18-,19+,21+/m1/s1 |
| InChIKey | VYKGRASPXUUIKX-LGDVWLEWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroascorbigen 5'-O-β-D-glucoside (CHEBI:65277) is a dihydroascorbigen hexoside (CHEBI:65017) |
| Synonym | Source |
|---|---|
| 5'-O-β-D-glucosyl dihydroascorbigen | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20690741 | Reaxys |
| Citations |
|---|