EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO4 |
| Net Charge | +1 |
| Average Mass | 177.200 |
| Monoisotopic Mass | 177.09956 |
| SMILES | *O[C@H]1[C@H](O)[C@@H]([NH3+])C(C)O[C@@H]1CO |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [4)-D-GlcpN-(1→](1+) residue (CHEBI:65271) is a organic cationic group (CHEBI:64769) |
| [4)-D-GlcpN-(1→](1+) residue (CHEBI:65271) is conjugate acid of [4)-D-GlcpN-(1→] residue (CHEBI:65272) |
| [4)-D-GlcpN-(1→](1+) residue (CHEBI:65271) is substituent group from 2-ammonio-2-deoxy-D-glucopyranose (CHEBI:58723) |
| Incoming Relation(s) |
| [4)-D-GlcpN-(1→] residue (CHEBI:65272) is conjugate base of [4)-D-GlcpN-(1→](1+) residue (CHEBI:65271) |
| Synonym | Source |
|---|---|
| (1→4)-D-glucosaminyl(1+) residue | ChEBI |
| UniProt Name | Source |
|---|---|
| D-glucosamine residue | UniProt |