EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO2 |
| Net Charge | +1 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07843 |
| SMILES | *C(=O)[C@@H]([NH3+])Cc1ccc(O)cc1 |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tyrosiniumyl group (CHEBI:65248) is a organic cationic group (CHEBI:64769) |
| L-tyrosiniumyl group (CHEBI:65248) is conjugate acid of L-tyrosyl group (CHEBI:32764) |
| L-tyrosiniumyl group (CHEBI:65248) is substituent group from L-tyrosinium (CHEBI:32762) |
| Incoming Relation(s) |
| L-tyrosyl group (CHEBI:32764) is conjugate base of L-tyrosiniumyl group (CHEBI:65248) |
| IUPAC Names |
|---|
| (2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoyl |
| (2S)-2-ammonio-3-(4-hydroxyphenyl)propanoyl |
| Synonyms | Source |
|---|---|
| L-tyrosyl(1+) | ChEBI |
| L-tyrosyl(1+) group | ChEBI |
| UniProt Name | Source |
|---|---|
| L-tyrosyl group | UniProt |