EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O2S |
| Net Charge | 0 |
| Average Mass | 162.254 |
| Monoisotopic Mass | 162.07145 |
| SMILES | CCCCCSCC(=O)O |
| InChI | InChI=1S/C7H14O2S/c1-2-3-4-5-10-6-7(8)9/h2-6H2,1H3,(H,8,9) |
| InChIKey | NBEYNZQBEQOQRG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(pentylsulfanyl)acetic acid (CHEBI:65241) has functional parent octanoic acid (CHEBI:28837) |
| 2-(pentylsulfanyl)acetic acid (CHEBI:65241) is a carboxylic acid (CHEBI:33575) |
| 2-(pentylsulfanyl)acetic acid (CHEBI:65241) is a sulfur-containing carboxylic acid (CHEBI:33576) |
| Incoming Relation(s) |
| 3-thiaoctanoyl-CoA (CHEBI:41611) has functional parent 2-(pentylsulfanyl)acetic acid (CHEBI:65241) |
| IUPAC Name |
|---|
| 2-(pentylsulfanyl)acetic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1702257 | Reaxys |