EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28O6 |
| Net Charge | 0 |
| Average Mass | 448.515 |
| Monoisotopic Mass | 448.18859 |
| SMILES | COc1ccc(-c2c(O)c3c(OC)c4c(c(CC=C(C)C)c3oc2=O)OC(C)(C)C=C4)cc1 |
| InChI | InChI=1S/C27H28O6/c1-15(2)7-12-18-23-19(13-14-27(3,4)33-23)24(31-6)21-22(28)20(26(29)32-25(18)21)16-8-10-17(30-5)11-9-16/h7-11,13-14,28H,12H2,1-6H3 |
| InChIKey | CCYKXDPVYWRNMH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Millettia richardiana (ncbitaxon:62121) | stem (BTO:0001300) | PubMed (24079177) |
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lonchocarpenin (CHEBI:6521) has role antiprotozoal drug (CHEBI:35820) |
| lonchocarpenin (CHEBI:6521) has role plant metabolite (CHEBI:76924) |
| lonchocarpenin (CHEBI:6521) is a hydroxycoumarin (CHEBI:37912) |
| lonchocarpenin (CHEBI:6521) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| 4-hydroxy-5-methoxy-3-(4-methoxyphenyl)-8,8-dimethyl-10-(3-methylbut-2-en-1-yl)-2H,8H-benzo[1,2-b:5,4-b']dipyran-2-one |
| Citations |
|---|