EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N4O6P |
| Net Charge | 0 |
| Average Mass | 270.182 |
| Monoisotopic Mass | 270.07292 |
| SMILES | N=C(N)NCCOP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H15N4O6P/c7-4(5(11)12)3-16-17(13,14)15-2-1-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H,13,14)(H4,8,9,10)/t4-/m0/s1 |
| InChIKey | GSDBGCKBBJVPNC-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-lombricine (CHEBI:16585) is a lombricine (CHEBI:25072) |
| L-lombricine (CHEBI:16585) is enantiomer of D-lombricine (CHEBI:32969) |
| L-lombricine (CHEBI:16585) is tautomer of L-lombricine dizwitterion (CHEBI:57825) |
| Incoming Relation(s) |
| N-phospho-L-lombricine (CHEBI:18039) has functional parent L-lombricine (CHEBI:16585) |
| D-lombricine (CHEBI:32969) is enantiomer of L-lombricine (CHEBI:16585) |
| L-lombricine dizwitterion (CHEBI:57825) is tautomer of L-lombricine (CHEBI:16585) |
| IUPAC Name |
|---|
| O-{[2-(carbamimidamido)ethoxy](hydroxy)phosphoryl}-L-serine |
| Synonyms | Source |
|---|---|
| O3-([2-guanidinoethoxy]phosphono)-L-serine | IUBMB |
| L-Lombricine | KEGG COMPOUND |
| Lombricine | KEGG COMPOUND |
| L-Serine, 2-((aminoiminomethyl)amino)ethyl hydrogen phosphate (ester) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14177 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729501 | Reaxys |
| CAS:18416-85-8 | ChemIDplus |
| CAS:18416-85-8 | KEGG COMPOUND |
| Citations |
|---|