EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N4O6P |
| Net Charge | 0 |
| Average Mass | 270.182 |
| Monoisotopic Mass | 270.07292 |
| SMILES | N=C(N)NCCOP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C6H15N4O6P/c7-4(5(11)12)3-16-17(13,14)15-2-1-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H,13,14)(H4,8,9,10) |
| InChIKey | GSDBGCKBBJVPNC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lumbricus terrestris (ncbitaxon:6398) | - | PubMed (1909513) |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lombricine (CHEBI:25072) has role animal metabolite (CHEBI:75767) |
| lombricine (CHEBI:25072) is a O-phosphoamino acid (CHEBI:21968) |
| lombricine (CHEBI:25072) is a guanidines (CHEBI:24436) |
| lombricine (CHEBI:25072) is a serine derivative (CHEBI:26649) |
| Incoming Relation(s) |
| D-lombricine (CHEBI:32969) is a lombricine (CHEBI:25072) |
| L-lombricine (CHEBI:16585) is a lombricine (CHEBI:25072) |
| IUPAC Name |
|---|
| O-[(2-carbamimidamidoethoxy)(hydroxy)phosphoryl]serine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729503 | Reaxys |
| Citations |
|---|