EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O9S |
| Net Charge | 0 |
| Average Mass | 260.220 |
| Monoisotopic Mass | 260.02020 |
| SMILES | O=S(=O)(O)O[C@@H]1[C@@H](O)[C@H](O)O[C@H](CO)[C@@H]1O |
| InChI | InChI=1S/C6H12O9S/c7-1-2-3(8)5(15-16(11,12)13)4(9)6(10)14-2/h2-10H,1H2,(H,11,12,13)/t2-,3+,4-,5+,6-/m1/s1 |
| InChIKey | HHRMGTRTCHNCRO-FDROIEKHSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-sulfo-β-D-galactose (CHEBI:65148) has functional parent β-D-galactose (CHEBI:27667) |
| 3-O-sulfo-β-D-galactose (CHEBI:65148) has role epitope (CHEBI:53000) |
| 3-O-sulfo-β-D-galactose (CHEBI:65148) is a monosaccharide sulfate (CHEBI:24589) |
| Incoming Relation(s) |
| β-D-Galp3S-(1→4)-D-Glcp (CHEBI:152485) has functional parent 3-O-sulfo-β-D-galactose (CHEBI:65148) |
| β-D-Galp3S-(1→4)-D-GlcpNAc (CHEBI:147626) has functional parent 3-O-sulfo-β-D-galactose (CHEBI:65148) |
| IUPAC Name |
|---|
| 3-O-sulfo-β-D-galactopyranose |
| Synonyms | Source |
|---|---|
| 3-O-sulfo-β-D-Gal | ChEBI |
| 3-O-sulfo-β-D-galactose | ChEBI |
| 3-O-sulfo-β-D-Galp | ChEBI |
| [3OSO3]Galβ | ChEBI |
| 3-O-sulfo-beta-D-galactopyranose | PDBeChem |
| O3-SULFONYLGALACTOSE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| SGA | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4354285 | Reaxys |
| Citations |
|---|