EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H25N3O4.HCl |
| Net Charge | 0 |
| Average Mass | 479.964 |
| Monoisotopic Mass | 479.16118 |
| SMILES | CNC(=O)c1cccc2cc(Oc3ccnc4cc(OCC5(N)CC5)c(OC)cc34)ccc12.Cl |
| InChI | InChI=1S/C26H25N3O4.ClH/c1-28-25(30)19-5-3-4-16-12-17(6-7-18(16)19)33-22-8-11-29-21-14-24(23(31-2)13-20(21)22)32-15-26(27)9-10-26;/h3-8,11-14H,9-10,15,27H2,1-2H3,(H,28,30);1H |
| InChIKey | QHPVWTJTATVJBR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| E-3810 (CHEBI:65138) has part E-3810(1+) (CHEBI:65208) |
| E-3810 (CHEBI:65138) has role antineoplastic agent (CHEBI:35610) |
| E-3810 (CHEBI:65138) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| E-3810 (CHEBI:65138) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| E-3810 (CHEBI:65138) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 6-({7-[(1-aminocyclopropyl)methoxy]-6-methoxyquinolin-4-yl}oxy)-N-methyl-1-naphthamide hydrochloride |
| 1-{[(6-methoxy-4-{[5-(methylcarbamoyl)-2-naphthyl]oxy}quinolin-7-yl)oxy]methyl}cyclopropanaminium chloride |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22181391 | Reaxys |
| Citations |
|---|