EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | NC(CCC(O)C=O)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c7-5(6(10)11)2-1-4(9)3-8/h3-5,9H,1-2,7H2,(H,10,11) |
| InChIKey | DAAGYSXTLYIDHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxyallysine (CHEBI:65125) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| erythro-L-hydroxyallysine (CHEBI:65126) is a hydroxyallysine (CHEBI:65125) |
| IUPAC Names |
|---|
| 5-hydroxy-6-oxonorleucine |
| 5-amino-3,4,5-trideoxyhexuronic acid |
| 2-amino-5-hydroxy-6-oxohexanoic acid |
| Synonym | Source |
|---|---|
| 5-hydroxyallysine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21123213 | Reaxys |