EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H38N2O19S |
| Net Charge | 0 |
| Average Mass | 666.608 |
| Monoisotopic Mass | 666.17895 |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[C@@H]3O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]3NC(C)=O)[C@H]2O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C22H38N2O19S/c1-6(27)23-11-16(32)18(9(4-26)39-20(11)34)42-22-17(33)19(14(30)8(3-25)40-22)43-21-12(24-7(2)28)15(31)13(29)10(41-21)5-38-44(35,36)37/h8-22,25-26,29-34H,3-5H2,1-2H3,(H,23,27)(H,24,28)(H,35,36,37)/t8-,9-,10-,11-,12-,13-,14+,15-,16-,17-,18-,19+,20-,21+,22+/m1/s1 |
| InChIKey | WPBMSLVPSZDYOZ-XFZXOASTSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-GlcpNAc6S-(1→3)-β-D-Galp-(1→4)-β-D-GlcpNAc (CHEBI:65120) has role epitope (CHEBI:53000) |
| β-D-GlcpNAc6S-(1→3)-β-D-Galp-(1→4)-β-D-GlcpNAc (CHEBI:65120) is a amino trisaccharide (CHEBI:59266) |
| β-D-GlcpNAc6S-(1→3)-β-D-Galp-(1→4)-β-D-GlcpNAc (CHEBI:65120) is a oligosaccharide sulfate (CHEBI:37909) |
| IUPAC Name |
|---|
| 2-acetamido-2-deoxy-6-O-sulfo-β-D-glucopyranosyl-(1→3)-β-D-galactopyranosyl-(1→4)-2-acetamido-2-deoxy-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| N-acetyl-6-O-sulfo-β-D-glucosaminyl-(1→3)-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosamine | ChEBI |
| (6SO3)GlcNAcβ1-3Galβ1-4GlcNAcβ | ChEBI |
| β-D-GlcNAc6S-(1→3)-β-D-Gal-(1→4)-β-D-GlcNAc | ChEBI |
| (6S)GlcNAcb1-3Galb1-4GlcNAcb | ChEBI |
| KDNa2-3Galb1-4(Fuca1-3)GlcNAc | ChEBI |
| Citations |
|---|