EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H35N4O13P |
| Net Charge | 0 |
| Average Mass | 534.456 |
| Monoisotopic Mass | 534.19382 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O[C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](N)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H35N4O13P/c18-2-6-10(23)12(25)8(21)16(31-6)33-14-5(20)1-4(19)9(22)15(14)34-17-13(26)11(24)7(32-17)3-30-35(27,28)29/h4-17,22-26H,1-3,18-21H2,(H2,27,28,29)/t4-,5+,6-,7-,8-,9+,10-,11-,12-,13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | YSYVVCNYHFEBSE-VVPCINPTSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5''-phosphoribostamycin (CHEBI:65113) has functional parent ribostamycin (CHEBI:45257) |
| 5''-phosphoribostamycin (CHEBI:65113) is a amino cyclitol glycoside (CHEBI:22479) |
| 5''-phosphoribostamycin (CHEBI:65113) is a glycoside phosphate (CHEBI:37549) |
| 5''-phosphoribostamycin (CHEBI:65113) is conjugate base of 5''-phosphoribostamycin(2+) (CHEBI:65082) |
| Incoming Relation(s) |
| 5''-phosphoribostamycin(2+) (CHEBI:65082) is conjugate acid of 5''-phosphoribostamycin (CHEBI:65113) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-3-hydroxy-2-[(5-O-phosphono-β-D-ribofuranosyl)oxy]cyclohexyl 2,6-diamino-2,6-dideoxy-α-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 5''-phosphovistamycin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18004 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11224684 | Reaxys |