EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO3 |
| Net Charge | 0 |
| Average Mass | 289.375 |
| Monoisotopic Mass | 289.16779 |
| SMILES | CN1C2CCC1CC(OC(=O)[C@H](O)Cc1ccccc1)C2 |
| InChI | InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)11-15(10-13)21-17(20)16(19)9-12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13?,14?,15?,16-/m1/s1 |
| InChIKey | FNRXUEYLFZLOEZ-LGGPCSOHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Littorine (CHEBI:6506) is a tropane alkaloid (CHEBI:37332) |
| Littorine (CHEBI:6506) is conjugate base of (R)-littorine(1+) (CHEBI:234341) |
| Incoming Relation(s) |
| (R)-littorine(1+) (CHEBI:234341) is conjugate acid of Littorine (CHEBI:6506) |
| Synonym | Source |
|---|---|
| Littorine | KEGG COMPOUND |