EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O5 |
| Net Charge | 0 |
| Average Mass | 196.158 |
| Monoisotopic Mass | 196.03717 |
| SMILES | O=C(O)C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H8O5/c10-8(9(11)12)5-1-2-6-7(3-5)14-4-13-6/h1-3,8,10H,4H2,(H,11,12) |
| InChIKey | CLUJFRCEPFNVHW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-methylenedioxymandelic acid (CHEBI:65054) has functional parent mandelic acid (CHEBI:35825) |
| 3,4-methylenedioxymandelic acid (CHEBI:65054) has role metabolite (CHEBI:25212) |
| 3,4-methylenedioxymandelic acid (CHEBI:65054) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 3,4-methylenedioxymandelic acid (CHEBI:65054) is a benzodioxoles (CHEBI:38298) |
| IUPAC Name |
|---|
| 1,3-benzodioxol-5-yl(hydroxy)acetic acid |
| Synonym | Source |
|---|---|
| alpha-Hydroxy-1,3-benzodioxole-5-acetic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:209546 | Reaxys |
| CAS:27738-46-1 | ChemIDplus |
| Citations |
|---|