EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8N2O2S |
| Net Charge | 0 |
| Average Mass | 232.264 |
| Monoisotopic Mass | 232.03065 |
| SMILES | O=C1Nc2ccccc2C1(O)c1nccs1 |
| InChI | InChI=1S/C11H8N2O2S/c14-9-11(15,10-12-5-6-16-10)7-3-1-2-4-8(7)13-9/h1-6,15H,(H,13,14) |
| InChIKey | BURKMBCVRAOKIE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-3-(thiazol-2-yl)indolin-2-one (CHEBI:65024) has functional parent indolin-2-one (CHEBI:31697) |
| 3-hydroxy-3-(thiazol-2-yl)indolin-2-one (CHEBI:65024) has role metabolite (CHEBI:25212) |
| 3-hydroxy-3-(thiazol-2-yl)indolin-2-one (CHEBI:65024) is a 1,3-thiazoles (CHEBI:38418) |
| 3-hydroxy-3-(thiazol-2-yl)indolin-2-one (CHEBI:65024) is a oxindoles (CHEBI:38459) |
| 3-hydroxy-3-(thiazol-2-yl)indolin-2-one (CHEBI:65024) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 3-hydroxy-3-(1,3-thiazol-2-yl)-2,3-dihydro-1H-indol-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8621280 | Reaxys |
| Citations |
|---|