EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8N2O2S |
| Net Charge | 0 |
| Average Mass | 232.264 |
| Monoisotopic Mass | 232.03065 |
| SMILES | [H]C(=O)Nc1ccccc1C(=O)c1nccs1 |
| InChI | InChI=1S/C11H8N2O2S/c14-7-13-9-4-2-1-3-8(9)10(15)11-12-5-6-16-11/h1-7H,(H,13,14) |
| InChIKey | BNYPSOBOWCDICB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-formamidophenyl-2'-thiazolylketone (CHEBI:65012) has functional parent 2-formylphenylformamide (CHEBI:18033) |
| 2-formamidophenyl-2'-thiazolylketone (CHEBI:65012) has role metabolite (CHEBI:25212) |
| 2-formamidophenyl-2'-thiazolylketone (CHEBI:65012) is a 1,3-thiazoles (CHEBI:38418) |
| 2-formamidophenyl-2'-thiazolylketone (CHEBI:65012) is a aromatic ketone (CHEBI:76224) |
| IUPAC Name |
|---|
| N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7131694 | Reaxys |
| Citations |
|---|