EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H29N3O8 |
| Net Charge | +2 |
| Average Mass | 367.399 |
| Monoisotopic Mass | 367.19437 |
| SMILES | CC(=O)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H]([NH3+])C[C@@H]2[NH3+])O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H27N3O8/c1-4(19)17-8-11(22)10(21)7(3-18)24-14(8)25-13-6(16)2-5(15)9(20)12(13)23/h5-14,18,20-23H,2-3,15-16H2,1H3,(H,17,19)/p+2/t5-,6+,7-,8-,9+,10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | ARLIVUJSSKFVPL-JPYLPOILSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-N-acetylparomamine(2+) (CHEBI:65010) is a ammonium ion derivative (CHEBI:35274) |
| 2'-N-acetylparomamine(2+) (CHEBI:65010) is a organic cation (CHEBI:25697) |
| 2'-N-acetylparomamine(2+) (CHEBI:65010) is conjugate acid of 2'-N-acetylparomamine (CHEBI:65018) |
| Incoming Relation(s) |
| 2'-N-acetylparomamine (CHEBI:65018) is conjugate base of 2'-N-acetylparomamine(2+) (CHEBI:65010) |
| IUPAC Name |
|---|
| (1R,3S,4R,5R,6S)-4-[(2-acetamido-2-deoxy-α-D-glucopyranosyl)oxy]-5,6-dihydroxycyclohexane-1,3-diaminium |
| UniProt Name | Source |
|---|---|
| 2'-N-acetylparomamine | UniProt |
| Citations |
|---|