EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2 |
| Net Charge | 0 |
| Average Mass | 146.193 |
| Monoisotopic Mass | 146.08440 |
| SMILES | NCc1cnc2ccccc12 |
| InChI | InChI=1S/C9H10N2/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5,10H2 |
| InChIKey | JXYGLMATGAAIBU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indol-3-ylmethylamine (CHEBI:65009) has role metabolite (CHEBI:25212) |
| indol-3-ylmethylamine (CHEBI:65009) is a aminoalkylindole (CHEBI:38631) |
| indol-3-ylmethylamine (CHEBI:65009) is a aralkylamino compound (CHEBI:64365) |
| indol-3-ylmethylamine (CHEBI:65009) is conjugate base of indol-3-ylmethylamine(1+) (CHEBI:136514) |
| Incoming Relation(s) |
| indol-3-ylmethylamine(1+) (CHEBI:136514) is conjugate acid of indol-3-ylmethylamine (CHEBI:65009) |
| IUPAC Name |
|---|
| 1-(1H-indol-3-yl)methanamine |
| Synonyms | Source |
|---|---|
| 1H-indol-3-ylmethanamine | ChEBI |
| AMI | MetaCyc |
| 3-aminomethylindole | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-8913 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4082 | Reaxys |