EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23N3O7 |
| Net Charge | 0 |
| Average Mass | 321.330 |
| Monoisotopic Mass | 321.15360 |
| SMILES | N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N)C[C@@H]2N)O[C@H](C=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23N3O7/c13-3-1-4(14)11(10(20)7(3)17)22-12-6(15)9(19)8(18)5(2-16)21-12/h2-12,17-20H,1,13-15H2/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | GLTSSBZZNLCFQJ-HKEUSBCWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6'-oxoparomamine (CHEBI:65008) has functional parent paromamine (CHEBI:7933) |
| 6'-oxoparomamine (CHEBI:65008) is a aldehyde (CHEBI:17478) |
| 6'-oxoparomamine (CHEBI:65008) is a aminoglycoside (CHEBI:47779) |
| 6'-oxoparomamine (CHEBI:65008) is a primary amino compound (CHEBI:50994) |
| 6'-oxoparomamine (CHEBI:65008) is a triamine (CHEBI:38751) |
| 6'-oxoparomamine (CHEBI:65008) is conjugate base of 6'-oxoparomamine(3+) (CHEBI:65016) |
| Incoming Relation(s) |
| 6'-oxoparomamine(3+) (CHEBI:65016) is conjugate acid of 6'-oxoparomamine (CHEBI:65008) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl 2-amino-2-deoxy-α-D-gluco-hexodialdo-1,5-pyranoside |
| Synonyms | Source |
|---|---|
| (2S,3S,4R,5R,6S)-5-azanyl-6-[(1R,2R,3S,4R,6S)-4,6-bis(azanyl)-2,3-bis(oxidanyl)cyclohexyl]oxy-3,4-bis(oxidanyl)oxane-2-carbaldehyde | ChEBI |
| 6'-dehydro-6'-oxoparomamine | KEGG COMPOUND |
| Citations |
|---|