EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | COc1cc(C[C@@H](CO)[C@H](CO)Cc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | PUETUDUXMCLALY-HOTGVXAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Taxus yunnanensis (ncbitaxon:147275) | xylem (BTO:0001468) | PubMed (21138310) | Previous component: wood; Aqueous extract of air-dried, powdered wood |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-secoisolariciresinol (CHEBI:65004) has role antidepressant (CHEBI:35469) |
| (−)-secoisolariciresinol (CHEBI:65004) has role phytoestrogen (CHEBI:76989) |
| (−)-secoisolariciresinol (CHEBI:65004) has role plant metabolite (CHEBI:76924) |
| (−)-secoisolariciresinol (CHEBI:65004) is a secoisolariciresinol (CHEBI:67250) |
| (−)-secoisolariciresinol (CHEBI:65004) is enantiomer of (+)-secoisolariciresinol (CHEBI:67247) |
| Incoming Relation(s) |
| 7-hydroxysecoisolariciresinol (CHEBI:88362) has functional parent (−)-secoisolariciresinol (CHEBI:65004) |
| (+)-secoisolariciresinol (CHEBI:67247) is enantiomer of (−)-secoisolariciresinol (CHEBI:65004) |
| IUPAC Name |
|---|
| (2R,3R)-2,3-bis(4-hydroxy-3-methoxybenzyl)butane-1,4-diol |
| Synonyms | Source |
|---|---|
| (-)-Secoisolariciresinol | KEGG COMPOUND |
| Secoisolariciresinol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (−)-secoisolariciresinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C18167 | KEGG COMPOUND |
| CPD-8909 | MetaCyc |
| HMDB0013692 | HMDB |
| LSM-5964 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1893026 | Reaxys |
| CAS:29388-59-8 | ChemIDplus |
| CAS:29388-59-8 | KEGG COMPOUND |
| Citations |
|---|