EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCC[C@H](O)[C@H](O)/C=C/C=C/C=C\C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-8-14-18(22)19(23)15-10-7-5-4-6-9-12-17(21)13-11-16-20(24)25/h4-7,9-10,12,15,17-19,21-23H,2-3,8,11,13-14,16H2,1H3,(H,24,25)/b6-4-,7-5+,12-9+,15-10+/t17-,18+,19-/m1/s1 |
| InChIKey | UXVRTOKOJOMENI-WLPVFMORSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lipoxin B4 (CHEBI:6499) has role human metabolite (CHEBI:77746) |
| lipoxin B4 (CHEBI:6499) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| lipoxin B4 (CHEBI:6499) is a lipoxin (CHEBI:6497) |
| lipoxin B4 (CHEBI:6499) is a long-chain fatty acid (CHEBI:15904) |
| lipoxin B4 (CHEBI:6499) is conjugate acid of lipoxin B4(1−) (CHEBI:67031) |
| Incoming Relation(s) |
| 20-hydroxylipoxin B4 (CHEBI:90978) has functional parent lipoxin B4 (CHEBI:6499) |
| lipoxin B4(1−) (CHEBI:67031) is conjugate base of lipoxin B4 (CHEBI:6499) |
| IUPAC Name |
|---|
| (5S,6E,8Z,10E,12E,14R,15S)-5,14,15-trihydroxyicosa-6,8,10,12-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 5,14,15-Thet | ChemIDplus |
| 5S,14R,15S-6,10,12-trans-8-cis-triHETE | ChEBI |
| 5S,14R,15S-8-cis-lipoxin B | ChEBI |
| (5S,14R,6E,8Z,10E,12E,15S)-5,14,15-trihydroxy-6,8,10,12-eicosatetraenoic acid | ChEBI |
| 5(S),14(R)-lipoxin B4 | ChEBI |
| (5S,6E,8Z,10E,12E,14R,15S)-5,14,15-trihydroxyeicosa-6,8,10,12-tetraenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C06315 | KEGG COMPOUND |
| LMFA03040002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4707370 | Reaxys |
| CAS:92950-25-9 | ChemIDplus |
| Citations |
|---|