EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25N5O8S |
| Net Charge | -2 |
| Average Mass | 531.547 |
| Monoisotopic Mass | 531.14348 |
| SMILES | N#CC(SC[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])c1cnc2ccccc12 |
| InChI | InChI=1S/C23H27N5O8S/c24-9-18(13-10-26-15-4-2-1-3-12(13)15)37-11-17(27-19(29)7-5-14(25)22(33)34)21(32)28-16(23(35)36)6-8-20(30)31/h1-4,10,14,16-18,26H,5-8,11,25H2,(H,27,29)(H,28,32)(H,30,31)(H,33,34)(H,35,36)/p-2/t14-,16-,17-,18?/m0/s1 |
| InChIKey | VIFUUCKOHMULOK-PNQBHLATSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γGluCys(IAN)Glu(2−) (CHEBI:64979) is a peptide anion (CHEBI:60334) |
| γGluCys(IAN)Glu(2−) (CHEBI:64979) is conjugate base of γGluCys(IAN)Glu (CHEBI:64978) |
| Incoming Relation(s) |
| γGluCys(IAN)Glu (CHEBI:64978) is conjugate acid of γGluCys(IAN)Glu(2−) (CHEBI:64979) |
| IUPAC Name |
|---|
| (2S)-2-({N-[(4S)-4-azaniumyl-4-carboxylatobutanoyl]-S-[cyano(1H-indol-3-yl)methyl]-L-cysteinyl}amino)pentanedioate |
| Synonyms | Source |
|---|---|
| γGluCys(IAN)Glu dianion | ChEBI |
| γ-L-Glu-L-Cys-(IAN)-L-Glu dianion | ChEBI |