EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O3 |
| Net Charge | 0 |
| Average Mass | 426.641 |
| Monoisotopic Mass | 426.31340 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC=C(C)C)[C@@]1(C)CCC1=C2CC[C@@]2([H])C(C(=O)O)C(=O)CC[C@]12C |
| InChI | InChI=1S/C28H42O3/c1-17(2)7-6-8-18(3)20-11-12-21-19-9-10-23-25(26(30)31)24(29)14-16-28(23,5)22(19)13-15-27(20,21)4/h7,18,20-21,23,25H,6,8-16H2,1-5H3,(H,30,31)/t18-,20-,21+,23+,25?,27-,28-/m1/s1 |
| InChIKey | HJQQRBBWPSGDGS-UEZNEYGDSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-dehydro-4-carboxyzymosterol (CHEBI:64966) has functional parent zymosterol (CHEBI:18252) |
| 3-dehydro-4-carboxyzymosterol (CHEBI:64966) is a 3-oxo steroid (CHEBI:47788) |
| 3-dehydro-4-carboxyzymosterol (CHEBI:64966) is conjugate acid of 3-dehydro-4-carboxyzymosterol(1−) (CHEBI:64934) |
| Incoming Relation(s) |
| 3-dehydro-4-carboxyzymosterol(1−) (CHEBI:64934) is conjugate base of 3-dehydro-4-carboxyzymosterol (CHEBI:64966) |
| IUPAC Name |
|---|
| 3-oxo-5α-cholesta-8,24-diene-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-carboxy-5α-cholesta-8(9),24-dien-3-one | ChEBI |
| (5α)-3-oxocholesta-8,24-diene-4-carboxylic acid | IUPAC |
| (5α)-4-carboxycholesta-8,24-dien-3-one | ChEBI |