EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N2O10S2 |
| Net Charge | -1 |
| Average Mass | 477.493 |
| Monoisotopic Mass | 477.06431 |
| SMILES | COn1cc(CC(=NOS(=O)(=O)[O-])S[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2ccccc21 |
| InChI | InChI=1S/C17H22N2O10S2/c1-27-19-7-9(10-4-2-3-5-11(10)19)6-13(18-29-31(24,25)26)30-17-16(23)15(22)14(21)12(8-20)28-17/h2-5,7,12,14-17,20-23H,6,8H2,1H3,(H,24,25,26)/p-1/t12-,14-,15+,16-,17+/m1/s1 |
| InChIKey | PKKMITFKYRCCOL-CMZRPVNOSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neoglucobrassicin(1−) (CHEBI:64965) is a indolylmethylglucosinolate (CHEBI:24796) |
| neoglucobrassicin(1−) (CHEBI:64965) is conjugate base of neoglucobrassicin (CHEBI:27506) |
| Incoming Relation(s) |
| neoglucobrassicin (CHEBI:27506) is conjugate acid of neoglucobrassicin(1−) (CHEBI:64965) |
| IUPAC Name |
|---|
| 1-S-[2-(1-methoxy-1H-indol-3-yl)-N-(sulfonatooxy)ethanimidoyl]-1-thio-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| neoglucobrassicin anion | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1-METHOXY-3-INDOLYLMETHYL-GLUCOSINOLATE | MetaCyc |
| C08424 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20282418 | Reaxys |