EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15O8P |
| Net Charge | 0 |
| Average Mass | 246.152 |
| Monoisotopic Mass | 246.05045 |
| SMILES | O=P(O)(OC[C@H](O)CO)OC[C@@H](O)CO |
| InChI | InChI=1S/C6H15O8P/c7-1-5(9)3-13-15(11,12)14-4-6(10)2-8/h5-10H,1-4H2,(H,11,12)/t5-,6+ |
| InChIKey | LLCSXHMJULHSJN-OLQVQODUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sn-glycero-3-phospho-(1'-sn-glycerol) (CHEBI:64956) is a glycerophosphoglycerol (CHEBI:5457) |
| sn-glycero-3-phospho-(1'-sn-glycerol) (CHEBI:64956) is conjugate acid of sn-glycero-3-phospho-(1'-sn-glycerol)(1−) (CHEBI:64717) |
| Incoming Relation(s) |
| sn-glycero-3-phospho-(1'-sn-glycerol)(1−) (CHEBI:64717) is conjugate base of sn-glycero-3-phospho-(1'-sn-glycerol) (CHEBI:64956) |
| IUPAC Name |
|---|
| (2R)-2,3-dihydroxypropyl (2S)-2,3-dihydroxypropyl hydrogen phosphate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2051861 | Reaxys |