EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO6 |
| Net Charge | 0 |
| Average Mass | 305.286 |
| Monoisotopic Mass | 305.08994 |
| SMILES | [H][C@]12OC(=O)C(O)(Cc3cnc4ccccc34)[C@@]1(O)OC[C@@H]2O |
| InChI | InChI=1S/C15H15NO6/c17-11-7-21-15(20)12(11)22-13(18)14(15,19)5-8-6-16-10-4-2-1-3-9(8)10/h1-4,6,11-12,16-17,19-20H,5,7H2/t11-,12+,14?,15-/m0/s1 |
| InChIKey | OMSJCIOTCFHSIT-KNUOEEMSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascorbigen (CHEBI:64944) has functional parent L-ascorbic acid (CHEBI:29073) |
| ascorbigen (CHEBI:64944) has role metabolite (CHEBI:25212) |
| ascorbigen (CHEBI:64944) is a indolyl carbohydrate (CHEBI:24821) |
| IUPAC Name |
|---|
| (3aS,6S,6aR)-3,3a,6-trihydroxy-3-(1H-indol-3-ylmethyl)tetrahydrofuro[3,2-b]furan-2(3H)-one |
| Synonym | Source |
|---|---|
| indol-3-ylmethyl-ascorbate | MetaCyc |
| Citations |
|---|