EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | [H]C(C(=O)C(=O)O)=C1C=CC(O)CC1 |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1,3,5,7,10H,2,4H2,(H,12,13) |
| InChIKey | MPMDLNLJFJLITQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-hydroxycyclohex-2-en-1-ylidene)pyruvic acid (CHEBI:64942) has functional parent pyruvic acid (CHEBI:32816) |
| 3-(4-hydroxycyclohex-2-en-1-ylidene)pyruvic acid (CHEBI:64942) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 3-(4-hydroxycyclohex-2-en-1-ylidene)pyruvic acid (CHEBI:64942) is a secondary alcohol (CHEBI:35681) |
| 3-(4-hydroxycyclohex-2-en-1-ylidene)pyruvic acid (CHEBI:64942) is conjugate acid of 3-(4-hydroxycyclohex-2-en-1-ylidene)pyruvate (CHEBI:64789) |
| Incoming Relation(s) |
| 3-[(1E,4R)-4-hydroxycyclohex-2-en-1-ylidene]pyruvic acid (CHEBI:85357) is a 3-(4-hydroxycyclohex-2-en-1-ylidene)pyruvic acid (CHEBI:64942) |
| 3-[(1Z,4R)-4-hydroxycyclohex-2-en-1-ylidene]pyruvic acid (CHEBI:137658) is a 3-(4-hydroxycyclohex-2-en-1-ylidene)pyruvic acid (CHEBI:64942) |
| 3-(4-hydroxycyclohex-2-en-1-ylidene)pyruvate (CHEBI:64789) is conjugate base of 3-(4-hydroxycyclohex-2-en-1-ylidene)pyruvic acid (CHEBI:64942) |
| IUPAC Name |
|---|
| 3-(4-hydroxycyclohex-2-en-1-ylidene)-2-oxopropanoic acid |