EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N3O5P |
| Net Charge | 0 |
| Average Mass | 235.136 |
| Monoisotopic Mass | 235.03581 |
| SMILES | N[C@@H](Cc1cncn1P(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C6H10N3O5P/c7-5(6(10)11)1-4-2-8-3-9(4)15(12,13)14/h2-3,5H,1,7H2,(H,10,11)(H2,12,13,14)/t5-/m0/s1 |
| InChIKey | VOHVXLVXSYAFOA-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nπ-phospho-L-histidine (CHEBI:64938) is a L-histidine derivative (CHEBI:84076) |
| Nπ-phospho-L-histidine (CHEBI:64938) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| Nπ-phospho-L-histidine residue (CHEBI:64936) is substituent group from Nπ-phospho-L-histidine (CHEBI:64938) |
| IUPAC Name |
|---|
| Nπ-phosphono-L-histidine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:675795 | Reaxys |