EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C5H8)n.C7H6O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | [H]C/C(C)=C/Cc1cc(C(=O)O)cc(O)c1O |
| InChI | InChI=1S/C12H14O4/c1-7(2)3-4-8-5-9(12(15)16)6-10(13)11(8)14/h3,5-6,13-14H,4H2,1-2H3,(H,15,16) |
| InChIKey | NMAKQSXJWYBYRF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydroxy-5-polyprenylbenzoic acid (CHEBI:64921) is a benzoic acids (CHEBI:22723) |
| 3,4-dihydroxy-5-polyprenylbenzoic acid (CHEBI:64921) is conjugate acid of 3,4-dihydroxy-5-polyprenylbenzoate (CHEBI:64694) |
| Incoming Relation(s) |
| 3,4-dihydroxy-5-polyprenylbenzoate (CHEBI:64694) is conjugate base of 3,4-dihydroxy-5-polyprenylbenzoic acid (CHEBI:64921) |