EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15O3 |
| Net Charge | -1 |
| Average Mass | 183.227 |
| Monoisotopic Mass | 183.10267 |
| SMILES | CC1=C(O)C[C@@H](CC(=O)[O-])C1(C)C |
| InChI | InChI=1S/C10H16O3/c1-6-8(11)4-7(5-9(12)13)10(6,2)3/h7,11H,4-5H2,1-3H3,(H,12,13)/p-1/t7-/m0/s1 |
| InChIKey | URJCZGFYOSRITQ-ZETCQYMHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-4-hydroxy-2,2,3-trimethylcyclopent-3-enyl]acetate (CHEBI:64894) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| [(1S)-4-hydroxy-2,2,3-trimethylcyclopent-3-enyl]acetate (CHEBI:64894) is conjugate base of [(1S)-4-hydroxy-2,2,3-trimethylcyclopent-3-enyl]acetic acid (CHEBI:64899) |
| Incoming Relation(s) |
| [(1S)-4-hydroxy-2,2,3-trimethylcyclopent-3-enyl]acetic acid (CHEBI:64899) is conjugate acid of [(1S)-4-hydroxy-2,2,3-trimethylcyclopent-3-enyl]acetate (CHEBI:64894) |
| IUPAC Name |
|---|
| [(1S)-4-hydroxy-2,2,3-trimethylcyclopent-3-en-1-yl]acetate |
| UniProt Name | Source |
|---|---|
| [(1S)-4-hydroxy-2,2,3-trimethylcyclopent-3-enyl]acetate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14305 | MetaCyc |
| Citations |
|---|