EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29N7O10P |
| Net Charge | -1 |
| Average Mass | 546.454 |
| Monoisotopic Mass | 546.17190 |
| SMILES | COC(=O)[C@H](CCCCNP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(=O)nc(N)nc32)[C@H](O)[C@@H]1O)NC(C)=O |
| InChI | InChI=1S/C19H30N7O10P/c1-9(27)23-10(18(31)34-2)5-3-4-6-22-37(32,33)35-7-11-13(28)14(29)17(36-11)26-8-21-12-15(26)24-19(20)25-16(12)30/h8,10-11,13-14,17,28-29H,3-7H2,1-2H3,(H,23,27)(H2,22,32,33)(H3,20,24,25,30)/p-1/t10-,11+,13+,14+,17+/m0/s1 |
| InChIKey | CFNHKQLBSCCNGG-YRGUDCOPSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nε-(5'-guanylyl)-Nα-acetyl-L-lysine methyl ester(1−) (CHEBI:64853) has functional parent guanosine 5'-monophosphate (CHEBI:17345) |
| Nε-(5'-guanylyl)-Nα-acetyl-L-lysine methyl ester(1−) (CHEBI:64853) is a organic phosphoramidate anion (CHEBI:60345) |
| Nε-(5'-guanylyl)-Nα-acetyl-L-lysine methyl ester(1−) (CHEBI:64853) is conjugate base of Nε-GMP-Nα-acetyl-L-lysine methyl ester (CHEBI:64856) |
| Incoming Relation(s) |
| Nε-GMP-Nα-acetyl-L-lysine methyl ester (CHEBI:64856) is conjugate acid of Nε-(5'-guanylyl)-Nα-acetyl-L-lysine methyl ester(1−) (CHEBI:64853) |
| Synonyms | Source |
|---|---|
| GMP-N-ε-(N-α-acetyl lysine methyl ester) 5'-phosphoramidate | SUBMITTER |
| Nε-GMP-Nα-acetyl-L-lysine methyl ester anion | ChEBI |
| Nε-GMP-Nα-acetyl-L-lysine methyl ester(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| Nε-(5'-guanylyl)-Nα-acetyl-L-lysine methyl ester | UniProt |
| Manual Xrefs | Databases |
|---|---|
| GMP-LYSINE-PHOSPHORAMIDATE | MetaCyc |