EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N2O5 |
| Net Charge | 0 |
| Average Mass | 176.128 |
| Monoisotopic Mass | 176.04332 |
| SMILES | NC(=O)N[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H8N2O5/c6-5(12)7-2(4(10)11)1-3(8)9/h2H,1H2,(H,8,9)(H,10,11)(H3,6,7,12)/t2-/m1/s1 |
| InChIKey | HLKXYZVTANABHZ-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-carbamoyl-D-aspartic acid (CHEBI:64852) is a N-carbamoylaspartic acid (CHEBI:64850) |
| Synonym | Source |
|---|---|
| N-carbamoyl-D-aspartic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6589263 | Reaxys |