EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O2 |
| Net Charge | 0 |
| Average Mass | 150.177 |
| Monoisotopic Mass | 150.06808 |
| SMILES | Cc1cccc(C)c1C(=O)O |
| InChI | InChI=1S/C9H10O2/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey | HCBHQDKBSKYGCK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethylbenzoic acid (CHEBI:64827) has functional parent benzoic acid (CHEBI:30746) |
| 2,6-dimethylbenzoic acid (CHEBI:64827) is a dimethylbenzoic acid (CHEBI:64810) |
| 2,6-dimethylbenzoic acid (CHEBI:64827) is conjugate acid of 2,6-dimethylbenzoate (CHEBI:64828) |
| Incoming Relation(s) |
| 2,6-dimethylbenzoate (CHEBI:64828) is conjugate base of 2,6-dimethylbenzoic acid (CHEBI:64827) |
| IUPAC Name |
|---|
| 2,6-dimethylbenzoic acid |
| Synonym | Source |
|---|---|
| 2,6-dimethylbenzene carboxylic acid | ChEBI |