EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 249.097 |
| Monoisotopic Mass | 248.01193 |
| SMILES | CON(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2O2/c1-13(15-2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14) |
| InChIKey | XKJMBINCVNINCA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linuron (CHEBI:6482) has functional parent N-methyl urea (CHEBI:44383) |
| linuron (CHEBI:6482) has role agrochemical (CHEBI:33286) |
| linuron (CHEBI:6482) has role environmental contaminant (CHEBI:78298) |
| linuron (CHEBI:6482) has role herbicide (CHEBI:24527) |
| linuron (CHEBI:6482) has role xenobiotic (CHEBI:35703) |
| linuron (CHEBI:6482) is a dichlorobenzene (CHEBI:23697) |
| linuron (CHEBI:6482) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea |
| Synonyms | Source |
|---|---|
| 1-Methoxy-1-methyl-3-(3,4-dichlorophenyl)urea | ChemIDplus |
| 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea | NIST Chemistry WebBook |
| N'-(3,4-dichlorophenyl)-N-methoxy-N-methyl Urea | NIST Chemistry WebBook |
| Citations |
|---|