EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O2 |
| Net Charge | 0 |
| Average Mass | 150.177 |
| Monoisotopic Mass | 150.06808 |
| SMILES | Cc1ccc(C(=O)O)c(C)c1 |
| InChI | InChI=1S/C9H10O2/c1-6-3-4-8(9(10)11)7(2)5-6/h3-5H,1-2H3,(H,10,11) |
| InChIKey | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dimethylbenzoic acid (CHEBI:64811) has functional parent benzoic acid (CHEBI:30746) |
| 2,4-dimethylbenzoic acid (CHEBI:64811) has role metabolite (CHEBI:25212) |
| 2,4-dimethylbenzoic acid (CHEBI:64811) is a dimethylbenzoic acid (CHEBI:64810) |
| 2,4-dimethylbenzoic acid (CHEBI:64811) is conjugate acid of 2,4-dimethylbenzoate (CHEBI:64812) |
| Incoming Relation(s) |
| 2,4-dimethylbenzoate (CHEBI:64812) is conjugate base of 2,4-dimethylbenzoic acid (CHEBI:64811) |
| IUPAC Name |
|---|
| 2,4-dimethylbenzoic acid |
| Synonym | Source |
|---|---|
| 4-carboxy-1,3-dimethylbenzene | NIST Chemistry WebBook |
| Citations |
|---|